C19H17ClN2O3 — CID 7227700
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (3S)-3-phenylbutanoate (PubChem CID 7227700) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (3S)-3-phenylbutanoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7227700 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-13(14-5-3-2-4-6-14)9-19(24)25-12-18(23)22-16-8-7-15(11-21)17(20)10-16/h2-8,10,13H,9,12H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | IELFCIAGCJCYEX-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |