C19H17ClN2O4 — CID 7555603
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate (PubChem CID 7555603) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate |
|---|---|
| PubChem CID | 7555603 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate |
| SMILES | CC[C@@H](Oc1ccccc1)C(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-2-17(26-15-6-4-3-5-7-15)19(24)25-12-18(23)22-14-9-8-13(11-21)16(20)10-14/h3-10,17H,2,12H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | KQGQARHRLFIMCG-QGZVFWFLSA-N |
| XLogP | 3.55 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |