C18H20N2O6S — CID 7229828
[2-oxo-2-(4-sulfamoylanilino)ethyl] (2R)-2-phenoxybutanoate (PubChem CID 7229828) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] (2R)-2-phenoxybutanoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] (2R)-2-phenoxybutanoate |
|---|---|
| PubChem CID | 7229828 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] (2R)-2-phenoxybutanoate |
| SMILES | CC[C@@H](Oc1ccccc1)C(=O)OCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20N2O6S/c1-2-16(26-14-6-4-3-5-7-14)18(22)25-12-17(21)20-13-8-10-15(11-9-13)27(19,23)24/h3-11,16H,2,12H2,1H3,(H,20,21)(H2,19,23,24)/t16-/m1/s1 |
| InChIKey | VGVVQIAAQQOKED-MRXNPFEDSA-N |
| XLogP | 1.67 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |