C20H24N2O5S — CID 7772394
[2-oxo-2-(4-sulfamoylanilino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate (PubChem CID 7772394) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 7772394 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](C(=O)OCC(=O)Nc1ccc(S(N)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-3-14(2)19(15-7-5-4-6-8-15)20(24)27-13-18(23)22-16-9-11-17(12-10-16)28(21,25)26/h4-12,14,19H,3,13H2,1-2H3,(H,22,23)(H2,21,25,26)/t14-,19-/m1/s1 |
| InChIKey | AFISIMWABXXIEQ-AUUYWEPGSA-N |
| XLogP | 2.65 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |