C21H24N2O4 — CID 8970656
[2-oxo-2-(phenylcarbamoylamino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate (PubChem CID 8970656) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is [2-oxo-2-(phenylcarbamoylamino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate.
| Compound Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 8970656 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] (2R,3R)-3-methyl-2-phenylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](C(=O)OCC(=O)NC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-15(2)19(16-10-6-4-7-11-16)20(25)27-14-18(24)23-21(26)22-17-12-8-5-9-13-17/h4-13,15,19H,3,14H2,1-2H3,(H2,22,23,24,26)/t15-,19-/m1/s1 |
| InChIKey | CYGFAMDUMAMBJI-DNVCBOLYSA-N |
| XLogP | 3.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |