C20H24N2O5S — CID 7811085
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (2R)-2-phenylbutanoate (PubChem CID 7811085) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (2R)-2-phenylbutanoate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 7811085 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OCC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-4-18(15-8-6-5-7-9-15)20(24)27-14-19(23)21-16-10-12-17(13-11-16)28(25,26)22(2)3/h5-13,18H,4,14H2,1-3H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | CVDLHUIRYPXGGB-GOSISDBHSA-N |
| XLogP | 2.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |