C19H20N2O4 — CID 2353550
[2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 2353550) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 2353550 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)Nc1ccc(C(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-2-16(13-6-4-3-5-7-13)19(24)25-12-17(22)21-15-10-8-14(9-11-15)18(20)23/h3-11,16H,2,12H2,1H3,(H2,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | PQGBSYKADXVPSS-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |