C19H19BrN2O4 — CID 18207921
[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-phenylbutanoate (PubChem CID 18207921) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-phenylbutanoate.
| Compound Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 18207921 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCC(=O)NNC(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H19BrN2O4/c1-2-16(13-6-4-3-5-7-13)19(25)26-12-17(23)21-22-18(24)14-8-10-15(20)11-9-14/h3-11,16H,2,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | ZZABLOOXROWDIT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|