C19H19Br2NO3 — CID 2089813
[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 2089813) has the molecular formula C19H19Br2NO3 and a molecular weight of 469.17 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate.
| Compound Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 2089813 |
| Molecular Formula | C19H19Br2NO3 |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)Nc1c(Br)cc(C)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C19H19Br2NO3/c1-3-14(13-7-5-4-6-8-13)19(24)25-11-17(23)22-18-15(20)9-12(2)10-16(18)21/h4-10,14H,3,11H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | XQDNXTVTIJBMIO-AWEZNQCLSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |