C20H22BrNO3 — CID 8753833
[2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 8753833) has the molecular formula C20H22BrNO3 and a molecular weight of 404.30 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate.
| Compound Name | [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 8753833 |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)N[C@H](C)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22BrNO3/c1-3-18(16-7-5-4-6-8-16)20(24)25-13-19(23)22-14(2)15-9-11-17(21)12-10-15/h4-12,14,18H,3,13H2,1-2H3,(H,22,23)/t14-,18+/m1/s1 |
| InChIKey | NBXFICDONDRGMP-KDOFPFPSSA-N |
| XLogP | 4.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |