C17H16BrNO3 — CID 2625805
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-bromobenzoate (PubChem CID 2625805) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-bromobenzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2625805 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-bromobenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16BrNO3/c1-12(13-5-3-2-4-6-13)19-16(20)11-22-17(21)14-7-9-15(18)10-8-14/h2-10,12H,11H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | HIUNDDRDQXXNFM-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |