C22H27N3O4 — CID 7734846
[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 7734846) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 7734846 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)OCC(=O)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-15(2)24-22(28)23-13-17-9-11-19(12-10-17)21(27)29-14-20(26)25-16(3)18-7-5-4-6-8-18/h4-12,15-16H,13-14H2,1-3H3,(H,25,26)(H2,23,24,28)/t16-/m1/s1 |
| InChIKey | MXXDJLYTJMMLCO-MRXNPFEDSA-N |
| XLogP | 2.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |