C19H21N3O5S — CID 8914754
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 8914754) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 8914754 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)OCC(=O)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H21N3O5S/c1-12(2)21-19(26)20-10-13-5-7-14(8-6-13)18(25)27-11-16(23)22-17(24)15-4-3-9-28-15/h3-9,12H,10-11H2,1-2H3,(H2,20,21,26)(H,22,23,24) |
| InChIKey | KSSSBMKANHCLSF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |