C15H14N2O5S2 — CID 97003900
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] (2R)-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 97003900) has the molecular formula C15H14N2O5S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (2R)-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (2R)-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 97003900 |
| Molecular Formula | C15H14N2O5S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (2R)-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | C[C@@H](NC(=O)c1cccs1)C(=O)OCC(=O)NC(=O)c1cccs1 |
| InChI | InChI=1S/C15H14N2O5S2/c1-9(16-13(19)10-4-2-6-23-10)15(21)22-8-12(18)17-14(20)11-5-3-7-24-11/h2-7,9H,8H2,1H3,(H,16,19)(H,17,18,20)/t9-/m1/s1 |
| InChIKey | CQAUHGKVLHBETB-SECBINFHSA-N |
| XLogP | 1.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |