C15H15N3O5S2 — CID 55484333
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(thiophene-2-carbonylamino)propanoate (PubChem CID 55484333) has the molecular formula C15H15N3O5S2 and a molecular weight of 381.44 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 55484333 |
| Molecular Formula | C15H15N3O5S2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(thiophene-2-carbonylamino)propanoate |
| SMILES | CC(NC(=O)c1cccs1)C(=O)OCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H15N3O5S2/c1-8(17-13(21)10-3-2-5-24-10)15(22)23-7-11(19)18-14-9(12(16)20)4-6-25-14/h2-6,8H,7H2,1H3,(H2,16,20)(H,17,21)(H,18,19) |
| InChIKey | LXIBMZFHSGLOOU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |