C15H16N2O4S2 — CID 55484501
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(thiophene-2-carbonylamino)propanoate (PubChem CID 55484501) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 55484501 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(thiophene-2-carbonylamino)propanoate |
| SMILES | CC(NC(=O)c1cccs1)C(=O)OCC(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H16N2O4S2/c1-10(17-14(19)12-5-3-7-23-12)15(20)21-9-13(18)16-8-11-4-2-6-22-11/h2-7,10H,8-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | VHBOJZNSSQOPFW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |