C16H17N3O6S2 — CID 55326686
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate (PubChem CID 55326686) has the molecular formula C16H17N3O6S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55326686 |
| Molecular Formula | C16H17N3O6S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
| SMILES | CC(NS(=O)(=O)c1ccccc1)C(=O)OCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C16H17N3O6S2/c1-10(19-27(23,24)11-5-3-2-4-6-11)16(22)25-9-13(20)18-15-12(14(17)21)7-8-26-15/h2-8,10,19H,9H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | WKMSILUKSSIVLN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |