C20H16N2O4S — CID 7554569
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7554569) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7554569 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-phenylbenzoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H16N2O4S/c21-18(24)16-10-11-27-19(16)22-17(23)12-26-20(25)15-9-5-4-8-14(15)13-6-2-1-3-7-13/h1-11H,12H2,(H2,21,24)(H,22,23) |
| InChIKey | XRFCFWFDLBRFPH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |