C17H13N3O4S — CID 3481111
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 3481111) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 3481111 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H13N3O4S/c18-15(22)11-7-8-25-16(11)20-14(21)9-24-17(23)13-6-5-10-3-1-2-4-12(10)19-13/h1-8H,9H2,(H2,18,22)(H,20,21) |
| InChIKey | XAXCBLWUNGMNKC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |