About [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate
[2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate (PubChem CID 3355066) has the molecular formula C25H20N2O4
and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate |
| PubChem CID | 3355066 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2n1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O4/c28-24(17-31-25(29)23-15-10-19-8-4-5-9-22(19)27-23)26-20-11-13-21(14-12-20)30-16-18-6-2-1-3-7-18/h1-15H,16-17H2,(H,26,28) |
| InChIKey | SZHDNTNVNPTFPY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate?
The IUPAC name of [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate (CID 3355066) is [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate.
What is the SMILES notation for [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate?
The canonical SMILES for [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate is O=C(COC(=O)c1ccc2ccccc2n1)Nc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate?
The InChIKey is SZHDNTNVNPTFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O4/c28-24(17-31-25(29)23-15-10-19-8-4-5-9-22(19)27-23)26-20-11-13-21(14-12-20)30-16-18-6-2-1-3-7-18/h1-15H,16-17H2,(H,26,28).
What are the key properties of [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate?
[2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate has a molecular weight of 412.45 g/mol, XLogP of 4.61, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenylmethoxyanilino)ethyl] quinoline-2-carboxylate is sourced from PubChem (CID 3355066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).