C26H16N2O5 — CID 4226974
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 4226974) has the molecular formula C26H16N2O5 and a molecular weight of 436.42 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 4226974 |
| Molecular Formula | C26H16N2O5 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2n1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H16N2O5/c29-23(14-33-26(32)22-12-9-15-5-1-4-8-21(15)28-22)27-16-10-11-19-20(13-16)25(31)18-7-3-2-6-17(18)24(19)30/h1-13H,14H2,(H,27,29) |
| InChIKey | GFUATUMIRDUGTL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|