C22H15N3O6 — CID 55734631
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate (PubChem CID 55734631) has the molecular formula C22H15N3O6 and a molecular weight of 417.38 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 55734631 |
| Molecular Formula | C22H15N3O6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate |
| SMILES | Cn1nc(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)ccc1=O |
| InChI | InChI=1S/C22H15N3O6/c1-25-19(27)9-8-17(24-25)22(30)31-11-18(26)23-12-6-7-15-16(10-12)21(29)14-5-3-2-4-13(14)20(15)28/h2-10H,11H2,1H3,(H,23,26) |
| InChIKey | AYYRPAFWIFTAQJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|