C25H19NO6 — CID 43024245
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 4-(methoxymethyl)benzoate (PubChem CID 43024245) has the molecular formula C25H19NO6 and a molecular weight of 429.43 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 4-(methoxymethyl)benzoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 4-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 43024245 |
| Molecular Formula | C25H19NO6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 4-(methoxymethyl)benzoate |
| SMILES | COCc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C25H19NO6/c1-31-13-15-6-8-16(9-7-15)25(30)32-14-22(27)26-17-10-11-20-21(12-17)24(29)19-5-3-2-4-18(19)23(20)28/h2-12H,13-14H2,1H3,(H,26,27) |
| InChIKey | WIJAJZNNILBLKB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|