C25H17N3O5 — CID 27560755
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 7-methylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 27560755) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 7-methylimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 7-methylimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 27560755 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 7-methylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | Cc1ccn2cc(C(=O)OCC(=O)Nc3ccc4c(c3)C(=O)c3ccccc3C4=O)nc2c1 |
| InChI | InChI=1S/C25H17N3O5/c1-14-8-9-28-12-20(27-21(28)10-14)25(32)33-13-22(29)26-15-6-7-18-19(11-15)24(31)17-5-3-2-4-16(17)23(18)30/h2-12H,13H2,1H3,(H,26,29) |
| InChIKey | CWMCHHDMZUVLAR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|