C28H19N3O6 — CID 42971479
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate (PubChem CID 42971479) has the molecular formula C28H19N3O6 and a molecular weight of 493.48 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 42971479 |
| Molecular Formula | C28H19N3O6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(=O)n(Cc2ccccc2)n1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H19N3O6/c32-24(16-37-28(36)23-12-13-25(33)31(30-23)15-17-6-2-1-3-7-17)29-18-10-11-21-22(14-18)27(35)20-9-5-4-8-19(20)26(21)34/h1-14H,15-16H2,(H,29,32) |
| InChIKey | OVZQLEIXDBBNJZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|