C20H20N4O6 — CID 32799796
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate (PubChem CID 32799796) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 32799796 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)ccc1=O |
| InChI | InChI=1S/C20H20N4O6/c1-3-4-9-24-17(26)8-7-15(22-24)20(29)30-11-16(25)21-12-5-6-13-14(10-12)19(28)23(2)18(13)27/h5-8,10H,3-4,9,11H2,1-2H3,(H,21,25) |
| InChIKey | VUWLBQNNIVISCX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|