C21H15N3O7 — CID 55378773
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55378773) has the molecular formula C21H15N3O7 and a molecular weight of 421.37 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55378773 |
| Molecular Formula | C21H15N3O7 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)c3ccc4c(c3)C(=O)N(C)C4=O)cc2C1=O |
| InChI | InChI=1S/C21H15N3O7/c1-23-17(26)12-5-3-10(7-14(12)19(23)28)21(30)31-9-16(25)22-11-4-6-13-15(8-11)20(29)24(2)18(13)27/h3-8H,9H2,1-2H3,(H,22,25) |
| InChIKey | YYINSGOHGRKGAO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|