C22H23N3O7S — CID 55377310
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 55377310) has the molecular formula C22H23N3O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55377310 |
| Molecular Formula | C22H23N3O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)c1 |
| InChI | InChI=1S/C22H23N3O7S/c1-4-25(5-2)33(30,31)16-8-6-7-14(11-16)22(29)32-13-19(26)23-15-9-10-17-18(12-15)21(28)24(3)20(17)27/h6-12H,4-5,13H2,1-3H3,(H,23,26) |
| InChIKey | GIIHRJZVAYGGGF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|