C23H25N3O7S — CID 42985535
[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 42985535) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 42985535 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2ccc(N3C(=O)CCC3=O)cc2)c1 |
| InChI | InChI=1S/C23H25N3O7S/c1-3-25(4-2)34(31,32)19-7-5-6-17(14-19)24-20(27)15-33-23(30)16-8-10-18(11-9-16)26-21(28)12-13-22(26)29/h5-11,14H,3-4,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | XJFIGGDQNVYADC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|