C21H25N3O6S — CID 55314654
[2-(4-acetamidoanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 55314654) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55314654 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O6S/c1-4-24(5-2)31(28,29)19-12-6-16(7-13-19)21(27)30-14-20(26)23-18-10-8-17(9-11-18)22-15(3)25/h6-13H,4-5,14H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | AZWCHJAAORFUFV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |