C19H17F5N2O5S — CID 2557746
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 2557746) has the molecular formula C19H17F5N2O5S and a molecular weight of 480.41 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2557746 |
| Molecular Formula | C19H17F5N2O5S |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H17F5N2O5S/c1-3-26(4-2)32(29,30)11-7-5-10(6-8-11)19(28)31-9-12(27)25-18-16(23)14(21)13(20)15(22)17(18)24/h5-8H,3-4,9H2,1-2H3,(H,25,27) |
| InChIKey | JVWJMFJPNLHPMA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|