C19H20FN3O7S — CID 2557753
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 2557753) has the molecular formula C19H20FN3O7S and a molecular weight of 453.45 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2557753 |
| Molecular Formula | C19H20FN3O7S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)cc1 |
| InChI | InChI=1S/C19H20FN3O7S/c1-3-22(4-2)31(28,29)15-8-5-13(6-9-15)19(25)30-12-18(24)21-17-11-14(23(26)27)7-10-16(17)20/h5-11H,3-4,12H2,1-2H3,(H,21,24) |
| InChIKey | BNCKHBZHLIYBHB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|