C17H15FN2O7 — CID 2518378
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3,5-dimethoxybenzoate (PubChem CID 2518378) has the molecular formula C17H15FN2O7 and a molecular weight of 378.31 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2518378 |
| Molecular Formula | C17H15FN2O7 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)c1 |
| InChI | InChI=1S/C17H15FN2O7/c1-25-12-5-10(6-13(8-12)26-2)17(22)27-9-16(21)19-15-7-11(20(23)24)3-4-14(15)18/h3-8H,9H2,1-2H3,(H,19,21) |
| InChIKey | FQZJOIMSRMLRFI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|