C17H14ClFN2O7 — CID 2499754
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 2499754) has the molecular formula C17H14ClFN2O7 and a molecular weight of 412.76 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2499754 |
| Molecular Formula | C17H14ClFN2O7 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)cc(Cl)c1OC |
| InChI | InChI=1S/C17H14ClFN2O7/c1-26-14-6-9(5-11(18)16(14)27-2)17(23)28-8-15(22)20-13-7-10(21(24)25)3-4-12(13)19/h3-7H,8H2,1-2H3,(H,20,22) |
| InChIKey | KPBLMQOFOYKRDV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|