C18H17ClFNO5 — CID 7253841
[2-(2-fluoroanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7253841) has the molecular formula C18H17ClFNO5 and a molecular weight of 381.79 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7253841 |
| Molecular Formula | C18H17ClFNO5 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCC(=O)Nc2ccccc2F)cc1OC |
| InChI | InChI=1S/C18H17ClFNO5/c1-3-25-17-12(19)8-11(9-15(17)24-2)18(23)26-10-16(22)21-14-7-5-4-6-13(14)20/h4-9H,3,10H2,1-2H3,(H,21,22) |
| InChIKey | NUOKRNRDYWNWGR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |