C19H19ClN2O6 — CID 7253702
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7253702) has the molecular formula C19H19ClN2O6 and a molecular weight of 406.82 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7253702 |
| Molecular Formula | C19H19ClN2O6 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCC(=O)NNC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H19ClN2O6/c1-3-27-17-14(20)9-13(10-15(17)26-2)19(25)28-11-16(23)21-22-18(24)12-7-5-4-6-8-12/h4-10H,3,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | HNYNPWKJKJYSIU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|