C20H22ClNO6 — CID 7654549
[2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7654549) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7654549 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(Cl)c(OCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22ClNO6/c1-4-26-15-8-6-14(7-9-15)22-18(23)12-28-20(24)13-10-16(21)19(27-5-2)17(11-13)25-3/h6-11H,4-5,12H2,1-3H3,(H,22,23) |
| InChIKey | PQQGETVOWOKYRQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |