C19H20ClNO6 — CID 7359100
[2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate (PubChem CID 7359100) has the molecular formula C19H20ClNO6 and a molecular weight of 393.82 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate |
|---|---|
| PubChem CID | 7359100 |
| Molecular Formula | C19H20ClNO6 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(Cl)c(O)c(OCC)c2)cc1 |
| InChI | InChI=1S/C19H20ClNO6/c1-3-25-14-7-5-13(6-8-14)21-17(22)11-27-19(24)12-9-15(20)18(23)16(10-12)26-4-2/h5-10,23H,3-4,11H2,1-2H3,(H,21,22) |
| InChIKey | QRIYKEGKVAWLLA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |