C23H21NO5 — CID 7133676
[2-(4-ethoxyanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7133676) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7133676 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ccc(-c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H21NO5/c1-2-28-21-13-9-19(10-14-21)24-22(26)15-29-23(27)18-5-3-16(4-6-18)17-7-11-20(25)12-8-17/h3-14,25H,2,15H2,1H3,(H,24,26) |
| InChIKey | YBUPNVRSJYKNTJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |