C21H17NO5 — CID 2387838
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-hydroxybenzoate (PubChem CID 2387838) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-hydroxybenzoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2387838 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO5/c23-17-10-6-15(7-11-17)21(25)26-14-20(24)22-16-8-12-19(13-9-16)27-18-4-2-1-3-5-18/h1-13,23H,14H2,(H,22,24) |
| InChIKey | NYIFJYYSBKPMGA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |