C22H20N2O4 — CID 7781322
[2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 4-aminobenzoate (PubChem CID 7781322) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 4-aminobenzoate.
| Compound Name | [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 7781322 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] 4-aminobenzoate |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)COC(=O)c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-15-2-10-19(11-3-15)28-20-12-8-18(9-13-20)24-21(25)14-27-22(26)16-4-6-17(23)7-5-16/h2-13H,14,23H2,1H3,(H,24,25) |
| InChIKey | KBSVTXZXRZLVSH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|