About [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate (PubChem CID 17259515) has the molecular formula C27H21NO5
and a molecular weight of 439.47 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate |
| PubChem CID | 17259515 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(Oc2ccccc2)cc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H21NO5/c29-26(28-21-13-17-25(18-14-21)33-23-9-5-2-6-10-23)19-31-27(30)20-11-15-24(16-12-20)32-22-7-3-1-4-8-22/h1-18H,19H2,(H,28,29) |
| InChIKey | ZSQOBGNGSOMZAC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate?
The IUPAC name of [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate (CID 17259515) is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate.
What is the SMILES notation for [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate?
The canonical SMILES for [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate is O=C(COC(=O)c1ccc(Oc2ccccc2)cc1)Nc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate?
The InChIKey is ZSQOBGNGSOMZAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21NO5/c29-26(28-21-13-17-25(18-14-21)33-23-9-5-2-6-10-23)19-31-27(30)20-11-15-24(16-12-20)32-22-7-3-1-4-8-22/h1-18H,19H2,(H,28,29).
What are the key properties of [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate?
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate has a molecular weight of 439.47 g/mol, XLogP of 6.07, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenoxyanilino)ethyl] 4-phenoxybenzoate is sourced from PubChem (CID 17259515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).