C30H22N2O6 — CID 44637901
[2-oxo-2-(4-phenoxyanilino)ethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 44637901) has the molecular formula C30H22N2O6 and a molecular weight of 506.51 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 44637901 |
| Molecular Formula | C30H22N2O6 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H22N2O6/c33-27(31-22-12-14-24(15-13-22)38-23-9-5-2-6-10-23)19-37-30(36)21-11-16-25-26(17-21)29(35)32(28(25)34)18-20-7-3-1-4-8-20/h1-17H,18-19H2,(H,31,33) |
| InChIKey | PBTDVMIRJAVQNN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|