C29H19ClN2O6 — CID 2477550
[2-oxo-2-(4-phenoxyanilino)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2477550) has the molecular formula C29H19ClN2O6 and a molecular weight of 526.93 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2477550 |
| Molecular Formula | C29H19ClN2O6 |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H19ClN2O6/c30-24-8-4-5-9-25(24)32-27(34)22-15-10-18(16-23(22)28(32)35)29(36)37-17-26(33)31-19-11-13-21(14-12-19)38-20-6-2-1-3-7-20/h1-16H,17H2,(H,31,33) |
| InChIKey | FABUMHHINONYBC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|