C24H23ClN2O5 — CID 16507286
[2-(cyclohexylmethylamino)-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16507286) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16507286 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O)NCC1CCCCC1 |
| InChI | InChI=1S/C24H23ClN2O5/c25-19-8-4-5-9-20(19)27-22(29)17-11-10-16(12-18(17)23(27)30)24(31)32-14-21(28)26-13-15-6-2-1-3-7-15/h4-5,8-12,15H,1-3,6-7,13-14H2,(H,26,28) |
| InChIKey | ZBAORSABUMIUEY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|