C16H10ClNO4 — CID 2336595
methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2336595) has the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2336595 |
| Molecular Formula | C16H10ClNO4 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C16H10ClNO4/c1-22-16(21)9-6-7-10-11(8-9)15(20)18(14(10)19)13-5-3-2-4-12(13)17/h2-8H,1H3 |
| InChIKey | MUVRSVJPFXXGQN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|