C23H15ClN2O6 — CID 108768103
methyl 3-[[2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-2-hydroxybenzoate (PubChem CID 108768103) has the molecular formula C23H15ClN2O6 and a molecular weight of 450.83 g/mol. Its IUPAC name is methyl 3-[[2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 108768103 |
| Molecular Formula | C23H15ClN2O6 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | methyl 3-[[2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2Cl)C3=O)c1O |
| InChI | InChI=1S/C23H15ClN2O6/c1-32-23(31)14-5-4-7-17(19(14)27)25-20(28)12-9-10-13-15(11-12)22(30)26(21(13)29)18-8-3-2-6-16(18)24/h2-11,27H,1H3,(H,25,28) |
| InChIKey | NZBWWUPCZKLKLY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|