C27H20ClN5O3 — CID 108768461
2-(2-chlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108768461) has the molecular formula C27H20ClN5O3 and a molecular weight of 497.94 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108768461 |
| Molecular Formula | C27H20ClN5O3 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1cc(C)nc(Nc2cccc(NC(=O)c3ccc4c(c3)C(=O)N(c3ccccc3Cl)C4=O)c2)n1 |
| InChI | InChI=1S/C27H20ClN5O3/c1-15-12-16(2)30-27(29-15)32-19-7-5-6-18(14-19)31-24(34)17-10-11-20-21(13-17)26(36)33(25(20)35)23-9-4-3-8-22(23)28/h3-14H,1-2H3,(H,31,34)(H,29,30,32) |
| InChIKey | LCQQGEDPUMGBGB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|