C21H12Cl2N2O3 — CID 1350530
N-(3,4-dichlorophenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide (PubChem CID 1350530) has the molecular formula C21H12Cl2N2O3 and a molecular weight of 411.24 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 1350530 |
| Molecular Formula | C21H12Cl2N2O3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc2c(c1)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C21H12Cl2N2O3/c22-17-9-7-13(11-18(17)23)24-19(26)12-6-8-15-16(10-12)21(28)25(20(15)27)14-4-2-1-3-5-14/h1-11H,(H,24,26) |
| InChIKey | QSEJVGBEMXCMGZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|