C21H14N2O5 — CID 17358826
N-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17358826) has the molecular formula C21H14N2O5 and a molecular weight of 374.35 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17358826 |
| Molecular Formula | C21H14N2O5 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc2c(c1)C(=O)N(c1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C21H14N2O5/c24-15-7-5-14(6-8-15)23-20(27)17-9-4-12(10-18(17)21(23)28)19(26)22-13-2-1-3-16(25)11-13/h1-11,24-25H,(H,22,26) |
| InChIKey | HNQMGUSOQLXFMK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|